C19H21N3O4S — CID 20914041
N-ethyl-1,4,7-trimethyl-2,3-dioxo-N-phenylquinoxaline-6-sulfonamide (PubChem CID 20914041) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is N-ethyl-1,4,7-trimethyl-2,3-dioxo-N-phenylquinoxaline-6-sulfonamide.
| Compound Name | N-ethyl-1,4,7-trimethyl-2,3-dioxo-N-phenylquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 20914041 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-ethyl-1,4,7-trimethyl-2,3-dioxo-N-phenylquinoxaline-6-sulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cc2c(cc1C)n(C)c(=O)c(=O)n2C |
| InChI | InChI=1S/C19H21N3O4S/c1-5-22(14-9-7-6-8-10-14)27(25,26)17-12-16-15(11-13(17)2)20(3)18(23)19(24)21(16)4/h6-12H,5H2,1-4H3 |
| InChIKey | GVOHBOHATYUAMZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 81.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|