C12H13N3O4S — CID 7658256
N-ethyl-2,4-dioxo-N-phenyl-1H-pyrimidine-5-sulfonamide (PubChem CID 7658256) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is N-ethyl-2,4-dioxo-N-phenyl-1H-pyrimidine-5-sulfonamide.
| Compound Name | N-ethyl-2,4-dioxo-N-phenyl-1H-pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 7658256 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-ethyl-2,4-dioxo-N-phenyl-1H-pyrimidine-5-sulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H13N3O4S/c1-2-15(9-6-4-3-5-7-9)20(18,19)10-8-13-12(17)14-11(10)16/h3-8H,2H2,1H3,(H2,13,14,16,17) |
| InChIKey | LXQHRMUOVJKJIC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |