C46H35N5O2S — CID 91514651
2-[6-[3-[4-(3,4-dimethoxyphenyl)phenyl]-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,3-thiazole (PubChem CID 91514651) has the molecular formula C46H35N5O2S and a molecular weight of 721.89 g/mol. Its IUPAC name is 2-[6-[3-[4-(3,4-dimethoxyphenyl)phenyl]-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,3-thiazole.
| Compound Name | 2-[6-[3-[4-(3,4-dimethoxyphenyl)phenyl]-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 91514651 |
| Molecular Formula | C46H35N5O2S |
| Molecular Weight | 721.89 g/mol |
| Exact Mass | 721.25 |
| IUPAC Name | 2-[6-[3-[4-(3,4-dimethoxyphenyl)phenyl]-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,3-thiazole |
| SMILES | COc1ccc(-c2ccc(-c3nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)cc3-c3ccc4ncc(-c5nccs5)n4c3)cc2)cc1OC |
| InChI | InChI=1S/C46H35N5O2S/c1-52-41-24-22-34(28-42(41)53-2)32-18-20-33(21-19-32)44-39(35-23-25-43-48-29-40(50(43)30-35)45-47-26-27-54-45)31-51(49-44)46(36-12-6-3-7-13-36,37-14-8-4-9-15-37)38-16-10-5-11-17-38/h3-31H,1-2H3 |
| InChIKey | UYEMVQNJVFJZHP-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 66.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.89 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|