C21H21ClFN7O2 — CID 91516309
N-(3-chlorophenyl)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-2-methoxypyridin-3-amine (PubChem CID 91516309) has the molecular formula C21H21ClFN7O2 and a molecular weight of 457.90 g/mol. Its IUPAC name is N-(3-chlorophenyl)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-2-methoxypyridin-3-amine.
| Compound Name | N-(3-chlorophenyl)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-2-methoxypyridin-3-amine |
|---|---|
| PubChem CID | 91516309 |
| Molecular Formula | C21H21ClFN7O2 |
| Molecular Weight | 457.90 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | N-(3-chlorophenyl)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-2-methoxypyridin-3-amine |
| SMILES | COc1nc(C/N=N/c2ncc(F)c(N3CCOCC3)n2)ccc1Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H21ClFN7O2/c1-31-20-18(26-15-4-2-3-14(22)11-15)6-5-16(27-20)12-25-29-21-24-13-17(23)19(28-21)30-7-9-32-10-8-30/h2-6,11,13,26H,7-10,12H2,1H3/b29-25+ |
| InChIKey | YNFNXINYRIANLH-XLVZBRSZSA-N |
| XLogP | 4.54 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.90 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|