C15H15NO5 — CID 91516403
1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid (PubChem CID 91516403) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid.
| Compound Name | 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 91516403 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid |
| SMILES | COC(=O)CC(=O)CC1c2ccccc2C=CN1C(=O)O |
| InChI | InChI=1S/C15H15NO5/c1-21-14(18)9-11(17)8-13-12-5-3-2-4-10(12)6-7-16(13)15(19)20/h2-7,13H,8-9H2,1H3,(H,19,20) |
| InChIKey | ZOKTZDVHARMGHP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|