1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid

C15H15NO5 — CID 91516403

IUPAC1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid
SMILESCOC(=O)CC(=O)CC1c2ccccc2C=CN1C(=O)O
InChIInChI=1S/C15H15NO5/c1-21-14(18)9-11(17)8-13-12-5-3-2-4-10(12)6-7-16(13)15(19)20/h2-7,13H,8-9H2,1H3,(H,19,20)
InChIKeyZOKTZDVHARMGHP-UHFFFAOYSA-N
MW289.29 g/mol
LogP2.21
Rot. Bonds4

About 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid

1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid (PubChem CID 91516403) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid.

Molecular Properties

Compound Name1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid
PubChem CID91516403
Molecular FormulaC15H15NO5
Molecular Weight289.29 g/mol
Exact Mass289.10
IUPAC Name1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid
SMILESCOC(=O)CC(=O)CC1c2ccccc2C=CN1C(=O)O
InChIInChI=1S/C15H15NO5/c1-21-14(18)9-11(17)8-13-12-5-3-2-4-10(12)6-7-16(13)15(19)20/h2-7,13H,8-9H2,1H3,(H,19,20)
InChIKeyZOKTZDVHARMGHP-UHFFFAOYSA-N
XLogP2.21
TPSA83.91 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.29
LogP ≤ 52.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid?
The IUPAC name of 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid (CID 91516403) is 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid.
What is the SMILES notation for 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid?
The canonical SMILES for 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid is COC(=O)CC(=O)CC1c2ccccc2C=CN1C(=O)O.
What is the InChIKey of 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid?
The InChIKey is ZOKTZDVHARMGHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO5/c1-21-14(18)9-11(17)8-13-12-5-3-2-4-10(12)6-7-16(13)15(19)20/h2-7,13H,8-9H2,1H3,(H,19,20).
What are the key properties of 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid?
1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid has a molecular weight of 289.29 g/mol, XLogP of 2.21, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxy-2,4-dioxobutyl)-1H-isoquinoline-2-carboxylic acid is sourced from PubChem (CID 91516403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).