C27H23N7O4 — CID 91517637
ethyl 2-[2-[2-(5-nitro-2-pyridinyl)pyrrol-2-yl]ethylamino]-4-quinolin-3-ylpyrimidine-5-carboxylate (PubChem CID 91517637) has the molecular formula C27H23N7O4 and a molecular weight of 509.53 g/mol. Its IUPAC name is ethyl 2-[2-[2-(5-nitro-2-pyridinyl)pyrrol-2-yl]ethylamino]-4-quinolin-3-ylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[2-[2-(5-nitro-2-pyridinyl)pyrrol-2-yl]ethylamino]-4-quinolin-3-ylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 91517637 |
| Molecular Formula | C27H23N7O4 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | ethyl 2-[2-[2-(5-nitro-2-pyridinyl)pyrrol-2-yl]ethylamino]-4-quinolin-3-ylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCCC2(c3ccc([N+](=O)[O-])cn3)C=CC=N2)nc1-c1cnc2ccccc2c1 |
| InChI | InChI=1S/C27H23N7O4/c1-2-38-25(35)21-17-31-26(33-24(21)19-14-18-6-3-4-7-22(18)29-15-19)28-13-11-27(10-5-12-32-27)23-9-8-20(16-30-23)34(36)37/h3-10,12,14-17H,2,11,13H2,1H3,(H,28,31,33) |
| InChIKey | XPNMFZDEFIJFSW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 145.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|