C27H25ClFN7O — CID 91517733
N-[3-(2-chloro-6-methylphenyl)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine (PubChem CID 91517733) has the molecular formula C27H25ClFN7O and a molecular weight of 518.00 g/mol. Its IUPAC name is N-[3-(2-chloro-6-methylphenyl)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine.
| Compound Name | N-[3-(2-chloro-6-methylphenyl)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 91517733 |
| Molecular Formula | C27H25ClFN7O |
| Molecular Weight | 518.00 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | N-[3-(2-chloro-6-methylphenyl)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine |
| SMILES | Cc1cccc(Cl)c1-c1cccc(Nc2ccc(C/N=N/c3ncc(F)c(N4CCOCC4)n3)nc2)c1 |
| InChI | InChI=1S/C27H25ClFN7O/c1-18-4-2-7-23(28)25(18)19-5-3-6-20(14-19)33-22-9-8-21(30-15-22)16-32-35-27-31-17-24(29)26(34-27)36-10-12-37-13-11-36/h2-9,14-15,17,33H,10-13,16H2,1H3/b35-32+ |
| InChIKey | XENVRRVRGRAUDK-LVYIWIAJSA-N |
| XLogP | 6.50 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.00 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|