C8H13FN2 — CID 91522104
(E)-(6-fluoro-4,5-dimethylcyclohex-2-en-1-ylidene)hydrazine (PubChem CID 91522104) has the molecular formula C8H13FN2 and a molecular weight of 156.20 g/mol. Its IUPAC name is (E)-(6-fluoro-4,5-dimethylcyclohex-2-en-1-ylidene)hydrazine.
| Compound Name | (E)-(6-fluoro-4,5-dimethylcyclohex-2-en-1-ylidene)hydrazine |
|---|---|
| PubChem CID | 91522104 |
| Molecular Formula | C8H13FN2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | (E)-(6-fluoro-4,5-dimethylcyclohex-2-en-1-ylidene)hydrazine |
| SMILES | CC1C=C/C(=N\N)C(F)C1C |
| InChI | InChI=1S/C8H13FN2/c1-5-3-4-7(11-10)8(9)6(5)2/h3-6,8H,10H2,1-2H3/b11-7+ |
| InChIKey | WTXQDLBPXQIUKX-YRNVUSSQSA-N |
| XLogP | 1.48 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|