C21H30O5 — CID 91524532
methyl (1R,13S,17S)-9,13-dimethyl-4-oxo-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadecane-17-carboxylate (PubChem CID 91524532) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is methyl (1R,13S,17S)-9,13-dimethyl-4-oxo-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadecane-17-carboxylate.
| Compound Name | methyl (1R,13S,17S)-9,13-dimethyl-4-oxo-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadecane-17-carboxylate |
|---|---|
| PubChem CID | 91524532 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | methyl (1R,13S,17S)-9,13-dimethyl-4-oxo-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadecane-17-carboxylate |
| SMILES | COC(=O)[C@]12CCC3[C@@]4(C)CCCC(C)C4CC4OC(=O)CC1[C@]43CO2 |
| InChI | InChI=1S/C21H30O5/c1-12-5-4-7-19(2)13(12)9-16-20-11-25-21(18(23)24-3,8-6-14(19)20)15(20)10-17(22)26-16/h12-16H,4-11H2,1-3H3/t12?,13?,14?,15?,16?,19-,20+,21-/m0/s1 |
| InChIKey | VGXWBOJSQFSURT-BAHHMPRHSA-N |
| XLogP | 3.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |