C25H34O9 — CID 541297
(3,4-diacetyloxy-2,6,17-trimethyl-11,14-dioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadecan-5-yl) acetate (PubChem CID 541297) has the molecular formula C25H34O9 and a molecular weight of 478.54 g/mol. Its IUPAC name is (3,4-diacetyloxy-2,6,17-trimethyl-11,14-dioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadecan-5-yl) acetate.
| Compound Name | (3,4-diacetyloxy-2,6,17-trimethyl-11,14-dioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadecan-5-yl) acetate |
|---|---|
| PubChem CID | 541297 |
| Molecular Formula | C25H34O9 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | (3,4-diacetyloxy-2,6,17-trimethyl-11,14-dioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadecan-5-yl) acetate |
| SMILES | CC(=O)OC1C(C)C2CC3OC(=O)CC4C(=O)CCC(C34C)C2(C)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C25H34O9/c1-11-15-9-19-24(5)16(10-20(30)34-19)17(29)7-8-18(24)25(15,6)23(33-14(4)28)22(32-13(3)27)21(11)31-12(2)26/h11,15-16,18-19,21-23H,7-10H2,1-6H3 |
| InChIKey | JQLPGARCOAOKCE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|