C25H34O9 — CID 541388
methyl 2-(5,6,7-triacetyloxy-4b,8-dimethyl-2-oxo-3,4,4a,5,6,7,8,8a,9,10-decahydrophenanthren-1-yl)acetate (PubChem CID 541388) has the molecular formula C25H34O9 and a molecular weight of 478.54 g/mol. Its IUPAC name is methyl 2-(5,6,7-triacetyloxy-4b,8-dimethyl-2-oxo-3,4,4a,5,6,7,8,8a,9,10-decahydrophenanthren-1-yl)acetate.
| Compound Name | methyl 2-(5,6,7-triacetyloxy-4b,8-dimethyl-2-oxo-3,4,4a,5,6,7,8,8a,9,10-decahydrophenanthren-1-yl)acetate |
|---|---|
| PubChem CID | 541388 |
| Molecular Formula | C25H34O9 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | methyl 2-(5,6,7-triacetyloxy-4b,8-dimethyl-2-oxo-3,4,4a,5,6,7,8,8a,9,10-decahydrophenanthren-1-yl)acetate |
| SMILES | COC(=O)CC1=C2CCC3C(C)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C3(C)C2CCC1=O |
| InChI | InChI=1S/C25H34O9/c1-12-18-8-7-16-17(11-21(30)31-6)20(29)10-9-19(16)25(18,5)24(34-15(4)28)23(33-14(3)27)22(12)32-13(2)26/h12,18-19,22-24H,7-11H2,1-6H3 |
| InChIKey | MBBKUKBVIFUPGC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|