C21H30O6 — CID 631463
methyl 3-(7-acetyloxy-10-hydroxy-4b-methyl-2-oxo-3,4,4a,5,6,7,8,8a,9,10-decahydrophenanthren-1-yl)propanoate (PubChem CID 631463) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is methyl 3-(7-acetyloxy-10-hydroxy-4b-methyl-2-oxo-3,4,4a,5,6,7,8,8a,9,10-decahydrophenanthren-1-yl)propanoate.
| Compound Name | methyl 3-(7-acetyloxy-10-hydroxy-4b-methyl-2-oxo-3,4,4a,5,6,7,8,8a,9,10-decahydrophenanthren-1-yl)propanoate |
|---|---|
| PubChem CID | 631463 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | methyl 3-(7-acetyloxy-10-hydroxy-4b-methyl-2-oxo-3,4,4a,5,6,7,8,8a,9,10-decahydrophenanthren-1-yl)propanoate |
| SMILES | COC(=O)CCC1=C2C(O)CC3CC(OC(C)=O)CCC3(C)C2CCC1=O |
| InChI | InChI=1S/C21H30O6/c1-12(22)27-14-8-9-21(2)13(10-14)11-18(24)20-15(4-7-19(25)26-3)17(23)6-5-16(20)21/h13-14,16,18,24H,4-11H2,1-3H3 |
| InChIKey | UVVOWSIAVBEUEW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |