C21H30O6 — CID 11100957
[(1R,2S,3S,4R,5S,7R,8S,9S,10R)-3,5-diacetyloxy-8,10-dideuterio-2,6,6-trimethyl-11-methylidene-4-tricyclo[5.4.0.02,9]undecanyl] acetate (PubChem CID 11100957) has the molecular formula C21H30O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is [(1R,2S,3S,4R,5S,7R,8S,9S,10R)-3,5-diacetyloxy-8,10-dideuterio-2,6,6-trimethyl-11-methylidene-4-tricyclo[5.4.0.02,9]undecanyl] acetate.
| Compound Name | [(1R,2S,3S,4R,5S,7R,8S,9S,10R)-3,5-diacetyloxy-8,10-dideuterio-2,6,6-trimethyl-11-methylidene-4-tricyclo[5.4.0.02,9]undecanyl] acetate |
|---|---|
| PubChem CID | 11100957 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [(1R,2S,3S,4R,5S,7R,8S,9S,10R)-3,5-diacetyloxy-8,10-dideuterio-2,6,6-trimethyl-11-methylidene-4-tricyclo[5.4.0.02,9]undecanyl] acetate |
| SMILES | [2H][C@@H]1[C@@H]2[C@@H]3C(=C)[C@H]([2H])[C@H]1[C@]3(C)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C2(C)C |
| InChI | InChI=1S/C21H30O6/c1-10-8-14-9-15-16(10)21(14,7)19(27-13(4)24)17(25-11(2)22)18(20(15,5)6)26-12(3)23/h14-19H,1,8-9H2,2-7H3/t14-,15-,16+,17-,18-,19-,21+/m1/s1/i8D,9D/t8-,9-,14+,15+,16-,17+,18+,19+,21-/m0 |
| InChIKey | ZMESIASPXJCZQJ-WCYXQXAESA-N |
| XLogP | 3.04 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|