C26H42N2O11P2 — CID 91524871
benzyl 4-[4-[bis(diethoxyphosphoryl)methylamino]-4-oxobutanoyl]oxypiperidine-1-carboxylate (PubChem CID 91524871) has the molecular formula C26H42N2O11P2 and a molecular weight of 620.57 g/mol. Its IUPAC name is benzyl 4-[4-[bis(diethoxyphosphoryl)methylamino]-4-oxobutanoyl]oxypiperidine-1-carboxylate.
| Compound Name | benzyl 4-[4-[bis(diethoxyphosphoryl)methylamino]-4-oxobutanoyl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 91524871 |
| Molecular Formula | C26H42N2O11P2 |
| Molecular Weight | 620.57 g/mol |
| Exact Mass | 620.23 |
| IUPAC Name | benzyl 4-[4-[bis(diethoxyphosphoryl)methylamino]-4-oxobutanoyl]oxypiperidine-1-carboxylate |
| SMILES | CCOP(=O)(OCC)C(NC(=O)CCC(=O)OC1CCN(C(=O)OCc2ccccc2)CC1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C26H42N2O11P2/c1-5-35-40(32,36-6-2)25(41(33,37-7-3)38-8-4)27-23(29)14-15-24(30)39-22-16-18-28(19-17-22)26(31)34-20-21-12-10-9-11-13-21/h9-13,22,25H,5-8,14-20H2,1-4H3,(H,27,29) |
| InChIKey | SSHPKVWWTYAGMO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 156.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|