About dioctyl propanedioate;2-methylpropane;phosphorosooxybenzene
dioctyl propanedioate;2-methylpropane;phosphorosooxybenzene (PubChem CID 91525194) has the molecular formula C29H51O6P
and a molecular weight of 526.70 g/mol. Its IUPAC name is dioctyl propanedioate;2-methylpropane;phosphorosooxybenzene.
Molecular Properties
| Compound Name | dioctyl propanedioate;2-methylpropane;phosphorosooxybenzene |
| PubChem CID | 91525194 |
| Molecular Formula | C29H51O6P |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | dioctyl propanedioate;2-methylpropane;phosphorosooxybenzene |
| SMILES | CC(C)C.CCCCCCCCOC(=O)CC(=O)OCCCCCCCC.O=POc1ccccc1 |
| InChI | InChI=1S/C19H36O4.C6H5O2P.C4H10/c1-3-5-7-9-11-13-15-22-18(20)17-19(21)23-16-14-12-10-8-6-4-2;7-9-8-6-4-2-1-3-5-6;1-4(2)3/h3-17H2,1-2H3;1-5H;4H,1-3H3 |
| InChIKey | YWRZJWDKMQFLSI-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dioctyl propanedioate;2-methylpropane;phosphorosooxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioctyl propanedioate;2-methylpropane;phosphorosooxybenzene?
The IUPAC name of dioctyl propanedioate;2-methylpropane;phosphorosooxybenzene (CID 91525194) is dioctyl propanedioate;2-methylpropane;phosphorosooxybenzene.
What is the SMILES notation for dioctyl propanedioate;2-methylpropane;phosphorosooxybenzene?
The canonical SMILES for dioctyl propanedioate;2-methylpropane;phosphorosooxybenzene is CC(C)C.CCCCCCCCOC(=O)CC(=O)OCCCCCCCC.O=POc1ccccc1.
What is the InChIKey of dioctyl propanedioate;2-methylpropane;phosphorosooxybenzene?
The InChIKey is YWRZJWDKMQFLSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O4.C6H5O2P.C4H10/c1-3-5-7-9-11-13-15-22-18(20)17-19(21)23-16-14-12-10-8-6-4-2;7-9-8-6-4-2-1-3-5-6;1-4(2)3/h3-17H2,1-2H3;1-5H;4H,1-3H3.
What are the key properties of dioctyl propanedioate;2-methylpropane;phosphorosooxybenzene?
dioctyl propanedioate;2-methylpropane;phosphorosooxybenzene has a molecular weight of 526.70 g/mol, XLogP of 9.12, 18 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dioctyl propanedioate;2-methylpropane;phosphorosooxybenzene is sourced from PubChem (CID 91525194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).