C35H62O8S — CID 163663729
1,4-dioctoxy-1,4-dioxobutane-2-sulfonic acid;nonoxybenzene (PubChem CID 163663729) has the molecular formula C35H62O8S and a molecular weight of 642.94 g/mol. Its IUPAC name is 1,4-dioctoxy-1,4-dioxobutane-2-sulfonic acid;nonoxybenzene.
| Compound Name | 1,4-dioctoxy-1,4-dioxobutane-2-sulfonic acid;nonoxybenzene |
|---|---|
| PubChem CID | 163663729 |
| Molecular Formula | C35H62O8S |
| Molecular Weight | 642.94 g/mol |
| Exact Mass | 642.42 |
| IUPAC Name | 1,4-dioctoxy-1,4-dioxobutane-2-sulfonic acid;nonoxybenzene |
| SMILES | CCCCCCCCCOc1ccccc1.CCCCCCCCOC(=O)CC(C(=O)OCCCCCCCC)S(=O)(=O)O |
| InChI | InChI=1S/C20H38O7S.C15H24O/c1-3-5-7-9-11-13-15-26-19(21)17-18(28(23,24)25)20(22)27-16-14-12-10-8-6-4-2;1-2-3-4-5-6-7-11-14-16-15-12-9-8-10-13-15/h18H,3-17H2,1-2H3,(H,23,24,25);8-10,12-13H,2-7,11,14H2,1H3 |
| InChIKey | IWOJVFBGUPNPQO-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.94 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|