C27H45NO8S — CID 175096077
benzamide;1,4-dioctoxy-1,4-dioxobutane-2-sulfonic acid (PubChem CID 175096077) has the molecular formula C27H45NO8S and a molecular weight of 543.72 g/mol. Its IUPAC name is benzamide;1,4-dioctoxy-1,4-dioxobutane-2-sulfonic acid.
| Compound Name | benzamide;1,4-dioctoxy-1,4-dioxobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 175096077 |
| Molecular Formula | C27H45NO8S |
| Molecular Weight | 543.72 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | benzamide;1,4-dioctoxy-1,4-dioxobutane-2-sulfonic acid |
| SMILES | CCCCCCCCOC(=O)CC(C(=O)OCCCCCCCC)S(=O)(=O)O.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H38O7S.C7H7NO/c1-3-5-7-9-11-13-15-26-19(21)17-18(28(23,24)25)20(22)27-16-14-12-10-8-6-4-2;8-7(9)6-4-2-1-3-5-6/h18H,3-17H2,1-2H3,(H,23,24,25);1-5H,(H2,8,9) |
| InChIKey | CBMZNFMHVSHMCG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 150.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.72 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|