C26H28ClN5O2 — CID 91525678
(3R,6S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(3-chlorophenyl)prop-2-enoyl]-6-methyl-3-propylpiperazin-2-one (PubChem CID 91525678) has the molecular formula C26H28ClN5O2 and a molecular weight of 478.00 g/mol. Its IUPAC name is (3R,6S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(3-chlorophenyl)prop-2-enoyl]-6-methyl-3-propylpiperazin-2-one.
| Compound Name | (3R,6S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(3-chlorophenyl)prop-2-enoyl]-6-methyl-3-propylpiperazin-2-one |
|---|---|
| PubChem CID | 91525678 |
| Molecular Formula | C26H28ClN5O2 |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | (3R,6S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(3-chlorophenyl)prop-2-enoyl]-6-methyl-3-propylpiperazin-2-one |
| SMILES | CCC[C@@H]1C(=O)N(Cc2ccc3c(N)ncnc3c2)[C@@H](C)CN1C(=O)C=Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C26H28ClN5O2/c1-3-5-23-26(34)31(15-19-8-10-21-22(13-19)29-16-30-25(21)28)17(2)14-32(23)24(33)11-9-18-6-4-7-20(27)12-18/h4,6-13,16-17,23H,3,5,14-15H2,1-2H3,(H2,28,29,30)/t17-,23+/m0/s1 |
| InChIKey | LEALZZVRKQSQCR-GAJHUEQPSA-N |
| XLogP | 4.31 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|