C13H13ClN2OS2 — CID 91525687
N-[(2-chlorophenyl)methyl]-2-[2-(sulfanylmethyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 91525687) has the molecular formula C13H13ClN2OS2 and a molecular weight of 312.85 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-[2-(sulfanylmethyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-[2-(sulfanylmethyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 91525687 |
| Molecular Formula | C13H13ClN2OS2 |
| Molecular Weight | 312.85 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-[2-(sulfanylmethyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | O=C(Cc1csc(CS)n1)NCc1ccccc1Cl |
| InChI | InChI=1S/C13H13ClN2OS2/c14-11-4-2-1-3-9(11)6-15-12(17)5-10-8-19-13(7-18)16-10/h1-4,8,18H,5-7H2,(H,15,17) |
| InChIKey | XKTDGNGNTFVXRE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.85 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|