C25H29ClFN9O — CID 91528322
N-[3-chloro-4-(4-methylpiperazin-2-yl)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine (PubChem CID 91528322) has the molecular formula C25H29ClFN9O and a molecular weight of 526.02 g/mol. Its IUPAC name is N-[3-chloro-4-(4-methylpiperazin-2-yl)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine.
| Compound Name | N-[3-chloro-4-(4-methylpiperazin-2-yl)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 91528322 |
| Molecular Formula | C25H29ClFN9O |
| Molecular Weight | 526.02 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | N-[3-chloro-4-(4-methylpiperazin-2-yl)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine |
| SMILES | CN1CCNC(c2ccc(Nc3ccc(C/N=N/c4ncc(F)c(N5CCOCC5)n4)nc3)cc2Cl)C1 |
| InChI | InChI=1S/C25H29ClFN9O/c1-35-7-6-28-23(16-35)20-5-4-17(12-21(20)26)32-19-3-2-18(29-13-19)14-31-34-25-30-15-22(27)24(33-25)36-8-10-37-11-9-36/h2-5,12-13,15,23,28,32H,6-11,14,16H2,1H3/b34-31+ |
| InChIKey | QTXRHZONUNXOTC-WUVHBKSUSA-N |
| XLogP | 4.10 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.02 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|