C24H26N2O2S — CID 91530914
N-(6-methoxy-1,3-benzothiazol-2-yl)-4-(3-prop-1-enylhex-3-enyl)benzamide (PubChem CID 91530914) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-4-(3-prop-1-enylhex-3-enyl)benzamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-4-(3-prop-1-enylhex-3-enyl)benzamide |
|---|---|
| PubChem CID | 91530914 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-4-(3-prop-1-enylhex-3-enyl)benzamide |
| SMILES | CC=CC(=CCC)CCc1ccc(C(=O)Nc2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C24H26N2O2S/c1-4-6-17(7-5-2)8-9-18-10-12-19(13-11-18)23(27)26-24-25-21-15-14-20(28-3)16-22(21)29-24/h4,6-7,10-16H,5,8-9H2,1-3H3,(H,25,26,27) |
| InChIKey | LJADINRJMHCPER-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|