C10H9N3 — CID 91531425
1-cyclohexa-1,3-dien-1-ylpyrazole-4-carbonitrile (PubChem CID 91531425) has the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-ylpyrazole-4-carbonitrile.
| Compound Name | 1-cyclohexa-1,3-dien-1-ylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 91531425 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-ylpyrazole-4-carbonitrile |
| SMILES | N#Cc1cnn(C2=CC=CCC2)c1 |
| InChI | InChI=1S/C10H9N3/c11-6-9-7-12-13(8-9)10-4-2-1-3-5-10/h1-2,4,7-8H,3,5H2 |
| InChIKey | CUSLMFKZBVCTQB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |