C10H9N2+ — CID 57286573
6H-pyrazolo[1,2-a]indazol-4-ium (PubChem CID 57286573) has the molecular formula C10H9N2+ and a molecular weight of 157.20 g/mol. Its IUPAC name is 6H-pyrazolo[1,2-a]indazol-4-ium.
| Compound Name | 6H-pyrazolo[1,2-a]indazol-4-ium |
|---|---|
| PubChem CID | 57286573 |
| Molecular Formula | C10H9N2+ |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.08 |
| IUPAC Name | 6H-pyrazolo[1,2-a]indazol-4-ium |
| SMILES | C1=CCc2c[n+]3cccn3c2=C1 |
| InChI | InChI=1S/C10H9N2/c1-2-5-10-9(4-1)8-11-6-3-7-12(10)11/h1-3,5-8H,4H2/q+1 |
| InChIKey | WUDRJQJQZKIRHQ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 8.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|