About platinum;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole
platinum;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole (PubChem CID 21044135) has the molecular formula C10H6F3N2Pt-
and a molecular weight of 406.24 g/mol. Its IUPAC name is platinum;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole.
Molecular Properties
| Compound Name | platinum;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole |
| PubChem CID | 21044135 |
| Molecular Formula | C10H6F3N2Pt- |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | platinum;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole |
| SMILES | FC(F)(F)c1c[c-]c(-n2cccn2)cc1.[Pt] |
| InChI | InChI=1S/C10H6F3N2.Pt/c11-10(12,13)8-2-4-9(5-3-8)15-7-1-6-14-15;/h1-4,6-7H;/q-1; |
| InChIKey | ZCIXXXKRZHORIZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze platinum;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole?
The IUPAC name of platinum;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole (CID 21044135) is platinum;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole.
What is the SMILES notation for platinum;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole?
The canonical SMILES for platinum;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole is FC(F)(F)c1c[c-]c(-n2cccn2)cc1.[Pt].
What is the InChIKey of platinum;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole?
The InChIKey is ZCIXXXKRZHORIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F3N2.Pt/c11-10(12,13)8-2-4-9(5-3-8)15-7-1-6-14-15;/h1-4,6-7H;/q-1;.
What are the key properties of platinum;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole?
platinum;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole has a molecular weight of 406.24 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for platinum;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole is sourced from PubChem (CID 21044135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).