C9H3F11N2 — CID 15321651
1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]pyrazole (PubChem CID 15321651) has the molecular formula C9H3F11N2 and a molecular weight of 348.12 g/mol. Its IUPAC name is 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]pyrazole.
| Compound Name | 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]pyrazole |
|---|---|
| PubChem CID | 15321651 |
| Molecular Formula | C9H3F11N2 |
| Molecular Weight | 348.12 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]pyrazole |
| SMILES | FC(F)(F)C(=C(n1cccn1)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H3F11N2/c10-6(11,9(18,19)20)5(22-3-1-2-21-22)4(7(12,13)14)8(15,16)17/h1-3H |
| InChIKey | VEOGSXVNVIDDGQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.12 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|