C18H18ClN3OS — CID 91532839
N-(7-azabicyclo[2.2.1]heptan-2-yl)-4-[(6-chloro-2-pyridinyl)sulfanyl]benzamide (PubChem CID 91532839) has the molecular formula C18H18ClN3OS and a molecular weight of 359.88 g/mol. Its IUPAC name is N-(7-azabicyclo[2.2.1]heptan-2-yl)-4-[(6-chloro-2-pyridinyl)sulfanyl]benzamide.
| Compound Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-4-[(6-chloro-2-pyridinyl)sulfanyl]benzamide |
|---|---|
| PubChem CID | 91532839 |
| Molecular Formula | C18H18ClN3OS |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-4-[(6-chloro-2-pyridinyl)sulfanyl]benzamide |
| SMILES | O=C(NC1CC2CCC1N2)c1ccc(Sc2cccc(Cl)n2)cc1 |
| InChI | InChI=1S/C18H18ClN3OS/c19-16-2-1-3-17(22-16)24-13-7-4-11(5-8-13)18(23)21-15-10-12-6-9-14(15)20-12/h1-5,7-8,12,14-15,20H,6,9-10H2,(H,21,23) |
| InChIKey | GLTWFVDDZLDUDM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|