C20H25NO2 — CID 91533506
1-(2-cyclohexyl-2-oxoethyl)-3,3-dimethyl-4H-isoquinoline-7-carbaldehyde (PubChem CID 91533506) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-(2-cyclohexyl-2-oxoethyl)-3,3-dimethyl-4H-isoquinoline-7-carbaldehyde.
| Compound Name | 1-(2-cyclohexyl-2-oxoethyl)-3,3-dimethyl-4H-isoquinoline-7-carbaldehyde |
|---|---|
| PubChem CID | 91533506 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 1-(2-cyclohexyl-2-oxoethyl)-3,3-dimethyl-4H-isoquinoline-7-carbaldehyde |
| SMILES | CC1(C)Cc2ccc(C=O)cc2C(CC(=O)C2CCCCC2)=N1 |
| InChI | InChI=1S/C20H25NO2/c1-20(2)12-16-9-8-14(13-22)10-17(16)18(21-20)11-19(23)15-6-4-3-5-7-15/h8-10,13,15H,3-7,11-12H2,1-2H3 |
| InChIKey | ZOIGFCQNQWYFMG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|