C13H13N3O — CID 91534977
1-(8-but-3-enylimidazo[1,2-a]pyrazin-2-yl)prop-2-en-1-one (PubChem CID 91534977) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 1-(8-but-3-enylimidazo[1,2-a]pyrazin-2-yl)prop-2-en-1-one.
| Compound Name | 1-(8-but-3-enylimidazo[1,2-a]pyrazin-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 91534977 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1-(8-but-3-enylimidazo[1,2-a]pyrazin-2-yl)prop-2-en-1-one |
| SMILES | C=CCCc1nccn2cc(C(=O)C=C)nc12 |
| InChI | InChI=1S/C13H13N3O/c1-3-5-6-10-13-15-11(12(17)4-2)9-16(13)8-7-14-10/h3-4,7-9H,1-2,5-6H2 |
| InChIKey | UZMYDRCUFZSWJJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|