About 4-methyl-5-methylidene-6,7-dihydro-1,4-thiazepine
4-methyl-5-methylidene-6,7-dihydro-1,4-thiazepine (PubChem CID 91536003) has the molecular formula C7H11NS
and a molecular weight of 141.24 g/mol. Its IUPAC name is 4-methyl-5-methylidene-6,7-dihydro-1,4-thiazepine.
Analyze 4-methyl-5-methylidene-6,7-dihydro-1,4-thiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-methylidene-6,7-dihydro-1,4-thiazepine?
The IUPAC name of 4-methyl-5-methylidene-6,7-dihydro-1,4-thiazepine (CID 91536003) is 4-methyl-5-methylidene-6,7-dihydro-1,4-thiazepine.
What is the SMILES notation for 4-methyl-5-methylidene-6,7-dihydro-1,4-thiazepine?
The canonical SMILES for 4-methyl-5-methylidene-6,7-dihydro-1,4-thiazepine is C=C1CCSC=CN1C.
What is the InChIKey of 4-methyl-5-methylidene-6,7-dihydro-1,4-thiazepine?
The InChIKey is CVAARPPMJDOPKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NS/c1-7-3-5-9-6-4-8(7)2/h4,6H,1,3,5H2,2H3.
What are the key properties of 4-methyl-5-methylidene-6,7-dihydro-1,4-thiazepine?
4-methyl-5-methylidene-6,7-dihydro-1,4-thiazepine has a molecular weight of 141.24 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-methylidene-6,7-dihydro-1,4-thiazepine is sourced from PubChem (CID 91536003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).