C11H21NS — CID 164570604
(Z)-N-(3-methylsulfanylpropyl)-N-prop-1-en-2-ylbut-1-en-1-amine (PubChem CID 164570604) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is (Z)-N-(3-methylsulfanylpropyl)-N-prop-1-en-2-ylbut-1-en-1-amine.
| Compound Name | (Z)-N-(3-methylsulfanylpropyl)-N-prop-1-en-2-ylbut-1-en-1-amine |
|---|---|
| PubChem CID | 164570604 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (Z)-N-(3-methylsulfanylpropyl)-N-prop-1-en-2-ylbut-1-en-1-amine |
| SMILES | C=C(C)N(/C=C\CC)CCCSC |
| InChI | InChI=1S/C11H21NS/c1-5-6-8-12(11(2)3)9-7-10-13-4/h6,8H,2,5,7,9-10H2,1,3-4H3/b8-6- |
| InChIKey | CMYYIKCFTWCCCA-VURMDHGXSA-N |
| XLogP | 3.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|