C13H24F6O5Si — CID 91536609
1,1,1,3,3,3-hexafluoropropan-2-one;2-hydroxybutanoic acid;trimethyl(propoxy)silane (PubChem CID 91536609) has the molecular formula C13H24F6O5Si and a molecular weight of 402.40 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-one;2-hydroxybutanoic acid;trimethyl(propoxy)silane.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-one;2-hydroxybutanoic acid;trimethyl(propoxy)silane |
|---|---|
| PubChem CID | 91536609 |
| Molecular Formula | C13H24F6O5Si |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-one;2-hydroxybutanoic acid;trimethyl(propoxy)silane |
| SMILES | CCC(O)C(=O)O.CCCO[Si](C)(C)C.O=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H16OSi.C4H8O3.C3F6O/c1-5-6-7-8(2,3)4;1-2-3(5)4(6)7;4-2(5,6)1(10)3(7,8)9/h5-6H2,1-4H3;3,5H,2H2,1H3,(H,6,7); |
| InChIKey | VYWCFLNNYLISDN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|