C10H19F3O3Si — CID 15724589
(2S)-2-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid (PubChem CID 15724589) has the molecular formula C10H19F3O3Si and a molecular weight of 272.34 g/mol. Its IUPAC name is (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid.
| Compound Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 15724589 |
| Molecular Formula | C10H19F3O3Si |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H19F3O3Si/c1-9(2,3)17(4,5)16-7(8(14)15)6-10(11,12)13/h7H,6H2,1-5H3,(H,14,15)/t7-/m0/s1 |
| InChIKey | FVWBDUWPTKFBNA-ZETCQYMHSA-N |
| XLogP | 3.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|