C14H27F3O3Si — CID 102580452
methyl 4,4,4-trifluoro-2-tri(propan-2-yl)silyloxybutanoate (PubChem CID 102580452) has the molecular formula C14H27F3O3Si and a molecular weight of 328.45 g/mol. Its IUPAC name is methyl 4,4,4-trifluoro-2-tri(propan-2-yl)silyloxybutanoate.
| Compound Name | methyl 4,4,4-trifluoro-2-tri(propan-2-yl)silyloxybutanoate |
|---|---|
| PubChem CID | 102580452 |
| Molecular Formula | C14H27F3O3Si |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | methyl 4,4,4-trifluoro-2-tri(propan-2-yl)silyloxybutanoate |
| SMILES | COC(=O)C(CC(F)(F)F)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C14H27F3O3Si/c1-9(2)21(10(3)4,11(5)6)20-12(13(18)19-7)8-14(15,16)17/h9-12H,8H2,1-7H3 |
| InChIKey | SCDIYOQPRDXMLU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|