C16H24FN3O5 — CID 91537289
pentyl N-[5-fluoro-1-(3-hydroxy-4,5-dimethyloxolan-2-yl)-2-oxopyrimidin-4-yl]carbamate (PubChem CID 91537289) has the molecular formula C16H24FN3O5 and a molecular weight of 357.38 g/mol. Its IUPAC name is pentyl N-[5-fluoro-1-(3-hydroxy-4,5-dimethyloxolan-2-yl)-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | pentyl N-[5-fluoro-1-(3-hydroxy-4,5-dimethyloxolan-2-yl)-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 91537289 |
| Molecular Formula | C16H24FN3O5 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | pentyl N-[5-fluoro-1-(3-hydroxy-4,5-dimethyloxolan-2-yl)-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCCCCOC(=O)Nc1nc(=O)n(C2OC(C)C(C)C2O)cc1F |
| InChI | InChI=1S/C16H24FN3O5/c1-4-5-6-7-24-16(23)19-13-11(17)8-20(15(22)18-13)14-12(21)9(2)10(3)25-14/h8-10,12,14,21H,4-7H2,1-3H3,(H,18,19,22,23) |
| InChIKey | MBHDVSJJFDGLIW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|