About 2,3-dimethylidenequinoline
2,3-dimethylidenequinoline (PubChem CID 91537528) has the molecular formula C11H9N
and a molecular weight of 155.20 g/mol. Its IUPAC name is 2,3-dimethylidenequinoline.
Molecular Properties
| Compound Name | 2,3-dimethylidenequinoline |
| PubChem CID | 91537528 |
| Molecular Formula | C11H9N |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 2,3-dimethylidenequinoline |
| SMILES | C=c1cc2ccccc2nc1=C |
| InChI | InChI=1S/C11H9N/c1-8-7-10-5-3-4-6-11(10)12-9(8)2/h3-7H,1-2H2 |
| InChIKey | SBYNTCCFFSYMDK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethylidenequinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylidenequinoline?
The IUPAC name of 2,3-dimethylidenequinoline (CID 91537528) is 2,3-dimethylidenequinoline.
What is the SMILES notation for 2,3-dimethylidenequinoline?
The canonical SMILES for 2,3-dimethylidenequinoline is C=c1cc2ccccc2nc1=C.
What is the InChIKey of 2,3-dimethylidenequinoline?
The InChIKey is SBYNTCCFFSYMDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N/c1-8-7-10-5-3-4-6-11(10)12-9(8)2/h3-7H,1-2H2.
What are the key properties of 2,3-dimethylidenequinoline?
2,3-dimethylidenequinoline has a molecular weight of 155.20 g/mol, XLogP of 1.06, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylidenequinoline is sourced from PubChem (CID 91537528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).