C13H14F3N — CID 123691887
N-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]cyclohex-2-en-1-imine (PubChem CID 123691887) has the molecular formula C13H14F3N and a molecular weight of 241.26 g/mol. Its IUPAC name is N-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]cyclohex-2-en-1-imine.
| Compound Name | N-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]cyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 123691887 |
| Molecular Formula | C13H14F3N |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]cyclohex-2-en-1-imine |
| SMILES | FC(F)(F)C1=CC(/N=C2/C=CCCC2)=CCC1 |
| InChI | InChI=1S/C13H14F3N/c14-13(15,16)10-5-4-8-12(9-10)17-11-6-2-1-3-7-11/h2,6,8-9H,1,3-5,7H2/b17-11- |
| InChIKey | YMOUFWMPUJJTPZ-BOPFTXTBSA-N |
| XLogP | 4.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|