C14H19F2N — CID 167030751
N-[1-(4-ethylcyclohexa-1,3-dien-1-yl)ethenyl]-3,3-difluorobutan-2-imine (PubChem CID 167030751) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is N-[1-(4-ethylcyclohexa-1,3-dien-1-yl)ethenyl]-3,3-difluorobutan-2-imine.
| Compound Name | N-[1-(4-ethylcyclohexa-1,3-dien-1-yl)ethenyl]-3,3-difluorobutan-2-imine |
|---|---|
| PubChem CID | 167030751 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-[1-(4-ethylcyclohexa-1,3-dien-1-yl)ethenyl]-3,3-difluorobutan-2-imine |
| SMILES | C=C(/N=C(\C)C(C)(F)F)C1=CC=C(CC)CC1 |
| InChI | InChI=1S/C14H19F2N/c1-5-12-6-8-13(9-7-12)10(2)17-11(3)14(4,15)16/h6,8H,2,5,7,9H2,1,3-4H3/b17-11+ |
| InChIKey | FIBMZAUZKBXKLG-GZTJUZNOSA-N |
| XLogP | 4.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|