C24H25Cl2N3O — CID 91539220
8-[bis(2-chlorophenyl)methyl]-3-(2-methylpyrazol-3-yl)-8-azabicyclo[3.2.1]octan-1-ol (PubChem CID 91539220) has the molecular formula C24H25Cl2N3O and a molecular weight of 442.39 g/mol. Its IUPAC name is 8-[bis(2-chlorophenyl)methyl]-3-(2-methylpyrazol-3-yl)-8-azabicyclo[3.2.1]octan-1-ol.
| Compound Name | 8-[bis(2-chlorophenyl)methyl]-3-(2-methylpyrazol-3-yl)-8-azabicyclo[3.2.1]octan-1-ol |
|---|---|
| PubChem CID | 91539220 |
| Molecular Formula | C24H25Cl2N3O |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 8-[bis(2-chlorophenyl)methyl]-3-(2-methylpyrazol-3-yl)-8-azabicyclo[3.2.1]octan-1-ol |
| SMILES | Cn1nccc1C1CC2CCC(O)(C1)N2C(c1ccccc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C24H25Cl2N3O/c1-28-22(11-13-27-28)16-14-17-10-12-24(30,15-16)29(17)23(18-6-2-4-8-20(18)25)19-7-3-5-9-21(19)26/h2-9,11,13,16-17,23,30H,10,12,14-15H2,1H3 |
| InChIKey | BHUYGYPDFVLOTL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |