C26H27Cl2N3O — CID 91393091
8-[bis(2-chlorophenyl)methyl]-3-(5-ethylpyrimidin-2-yl)-8-azabicyclo[3.2.1]octan-1-ol (PubChem CID 91393091) has the molecular formula C26H27Cl2N3O and a molecular weight of 468.43 g/mol. Its IUPAC name is 8-[bis(2-chlorophenyl)methyl]-3-(5-ethylpyrimidin-2-yl)-8-azabicyclo[3.2.1]octan-1-ol.
| Compound Name | 8-[bis(2-chlorophenyl)methyl]-3-(5-ethylpyrimidin-2-yl)-8-azabicyclo[3.2.1]octan-1-ol |
|---|---|
| PubChem CID | 91393091 |
| Molecular Formula | C26H27Cl2N3O |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 8-[bis(2-chlorophenyl)methyl]-3-(5-ethylpyrimidin-2-yl)-8-azabicyclo[3.2.1]octan-1-ol |
| SMILES | CCc1cnc(C2CC3CCC(O)(C2)N3C(c2ccccc2Cl)c2ccccc2Cl)nc1 |
| InChI | InChI=1S/C26H27Cl2N3O/c1-2-17-15-29-25(30-16-17)18-13-19-11-12-26(32,14-18)31(19)24(20-7-3-5-9-22(20)27)21-8-4-6-10-23(21)28/h3-10,15-16,18-19,24,32H,2,11-14H2,1H3 |
| InChIKey | LRMHXSJIEYTZHH-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |