C16H15N2O5S- — CID 9153988
2-[2-[2-(2-ethoxycarbonylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]acetate (PubChem CID 9153988) has the molecular formula C16H15N2O5S- and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-[2-[2-(2-ethoxycarbonylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-[2-[2-(2-ethoxycarbonylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 9153988 |
| Molecular Formula | C16H15N2O5S- |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 2-[2-[2-(2-ethoxycarbonylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)Cc1nc(CC(=O)[O-])cs1 |
| InChI | InChI=1S/C16H16N2O5S/c1-2-23-16(22)11-5-3-4-6-12(11)18-13(19)8-14-17-10(9-24-14)7-15(20)21/h3-6,9H,2,7-8H2,1H3,(H,18,19)(H,20,21)/p-1 |
| InChIKey | OOCHKPPUVDIRBE-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 108.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |