C12H20N2O4 — CID 91540710
(E)-2-[N'-ethyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]but-2-enoic acid (PubChem CID 91540710) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is (E)-2-[N'-ethyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]but-2-enoic acid.
| Compound Name | (E)-2-[N'-ethyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]but-2-enoic acid |
|---|---|
| PubChem CID | 91540710 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | (E)-2-[N'-ethyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]but-2-enoic acid |
| SMILES | C/C=C(C(=O)O)\C(=N\CC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20N2O4/c1-6-8(10(15)16)9(13-7-2)14-11(17)18-12(3,4)5/h6H,7H2,1-5H3,(H,15,16)(H,13,14,17)/b8-6+ |
| InChIKey | CUJSWALLHNZBHR-SOFGYWHQSA-N |
| XLogP | 1.96 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|