C39H50O3 — CID 91540744
6-[4-[3-methyl-4-(2-methyl-5-oxo-10-phenyldec-1-en-4-yl)phenyl]phenyl]nonanoic acid (PubChem CID 91540744) has the molecular formula C39H50O3 and a molecular weight of 566.83 g/mol. Its IUPAC name is 6-[4-[3-methyl-4-(2-methyl-5-oxo-10-phenyldec-1-en-4-yl)phenyl]phenyl]nonanoic acid.
| Compound Name | 6-[4-[3-methyl-4-(2-methyl-5-oxo-10-phenyldec-1-en-4-yl)phenyl]phenyl]nonanoic acid |
|---|---|
| PubChem CID | 91540744 |
| Molecular Formula | C39H50O3 |
| Molecular Weight | 566.83 g/mol |
| Exact Mass | 566.38 |
| IUPAC Name | 6-[4-[3-methyl-4-(2-methyl-5-oxo-10-phenyldec-1-en-4-yl)phenyl]phenyl]nonanoic acid |
| SMILES | C=C(C)CC(C(=O)CCCCCc1ccccc1)c1ccc(-c2ccc(C(CCC)CCCCC(=O)O)cc2)cc1C |
| InChI | InChI=1S/C39H50O3/c1-5-14-32(18-12-13-20-39(41)42)33-21-23-34(24-22-33)35-25-26-36(30(4)28-35)37(27-29(2)3)38(40)19-11-7-10-17-31-15-8-6-9-16-31/h6,8-9,15-16,21-26,28,32,37H,2,5,7,10-14,17-20,27H2,1,3-4H3,(H,41,42) |
| InChIKey | XLZLJRXGBGQJNA-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.83 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|