C10H6N2O3 — CID 91541128
6-(4-hydroxyphenyl)-1,4-diazabicyclo[3.1.0]hex-4-ene-2,3-dione (PubChem CID 91541128) has the molecular formula C10H6N2O3 and a molecular weight of 202.17 g/mol. Its IUPAC name is 6-(4-hydroxyphenyl)-1,4-diazabicyclo[3.1.0]hex-4-ene-2,3-dione.
| Compound Name | 6-(4-hydroxyphenyl)-1,4-diazabicyclo[3.1.0]hex-4-ene-2,3-dione |
|---|---|
| PubChem CID | 91541128 |
| Molecular Formula | C10H6N2O3 |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 6-(4-hydroxyphenyl)-1,4-diazabicyclo[3.1.0]hex-4-ene-2,3-dione |
| SMILES | O=C1N=C2C(c3ccc(O)cc3)N2C1=O |
| InChI | InChI=1S/C10H6N2O3/c13-6-3-1-5(2-4-6)7-8-11-9(14)10(15)12(7)8/h1-4,7,13H |
| InChIKey | LPCBFEAVBHDXDB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 69.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|