C12H12FN3O2 — CID 107693885
5-amino-3-cyclopropyl-4-(3-fluoro-4-hydroxyphenyl)-4H-imidazol-2-one (PubChem CID 107693885) has the molecular formula C12H12FN3O2 and a molecular weight of 249.25 g/mol. Its IUPAC name is 5-amino-3-cyclopropyl-4-(3-fluoro-4-hydroxyphenyl)-4H-imidazol-2-one.
| Compound Name | 5-amino-3-cyclopropyl-4-(3-fluoro-4-hydroxyphenyl)-4H-imidazol-2-one |
|---|---|
| PubChem CID | 107693885 |
| Molecular Formula | C12H12FN3O2 |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 5-amino-3-cyclopropyl-4-(3-fluoro-4-hydroxyphenyl)-4H-imidazol-2-one |
| SMILES | NC1=NC(=O)N(C2CC2)C1c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C12H12FN3O2/c13-8-5-6(1-4-9(8)17)10-11(14)15-12(18)16(10)7-2-3-7/h1,4-5,7,10,17H,2-3H2,(H2,14,15,18) |
| InChIKey | XYFUCORSCWLHJW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |