C17H24O4S — CID 91541767
[2-(1-hydroxy-4-methylcyclohex-3-en-1-yl)-1-(4-methylphenyl)propyl] hydrogen sulfite (PubChem CID 91541767) has the molecular formula C17H24O4S and a molecular weight of 324.44 g/mol. Its IUPAC name is [2-(1-hydroxy-4-methylcyclohex-3-en-1-yl)-1-(4-methylphenyl)propyl] hydrogen sulfite.
| Compound Name | [2-(1-hydroxy-4-methylcyclohex-3-en-1-yl)-1-(4-methylphenyl)propyl] hydrogen sulfite |
|---|---|
| PubChem CID | 91541767 |
| Molecular Formula | C17H24O4S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | [2-(1-hydroxy-4-methylcyclohex-3-en-1-yl)-1-(4-methylphenyl)propyl] hydrogen sulfite |
| SMILES | CC1=CCC(O)(C(C)C(OS(=O)O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C17H24O4S/c1-12-4-6-15(7-5-12)16(21-22(19)20)14(3)17(18)10-8-13(2)9-11-17/h4-8,14,16,18H,9-11H2,1-3H3,(H,19,20) |
| InChIKey | PAVTVDWUGBBTNU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|