About (2S,5S)-1-(2-bromoacetyl)pyrrolidine-2,5-dicarbonitrile
(2S,5S)-1-(2-bromoacetyl)pyrrolidine-2,5-dicarbonitrile (PubChem CID 91541810) has the molecular formula C8H8BrN3O
and a molecular weight of 242.08 g/mol. Its IUPAC name is (2S,5S)-1-(2-bromoacetyl)pyrrolidine-2,5-dicarbonitrile.
Molecular Properties
| Compound Name | (2S,5S)-1-(2-bromoacetyl)pyrrolidine-2,5-dicarbonitrile |
| PubChem CID | 91541810 |
| Molecular Formula | C8H8BrN3O |
| Molecular Weight | 242.08 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | (2S,5S)-1-(2-bromoacetyl)pyrrolidine-2,5-dicarbonitrile |
| SMILES | N#C[C@@H]1CC[C@@H](C#N)N1C(=O)CBr |
| InChI | InChI=1S/C8H8BrN3O/c9-3-8(13)12-6(4-10)1-2-7(12)5-11/h6-7H,1-3H2/t6-,7-/m0/s1 |
| InChIKey | RTOYOAYPWNAATO-BQBZGAKWSA-N |
| XLogP | 0.79 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.08 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S,5S)-1-(2-bromoacetyl)pyrrolidine-2,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-1-(2-bromoacetyl)pyrrolidine-2,5-dicarbonitrile?
The IUPAC name of (2S,5S)-1-(2-bromoacetyl)pyrrolidine-2,5-dicarbonitrile (CID 91541810) is (2S,5S)-1-(2-bromoacetyl)pyrrolidine-2,5-dicarbonitrile.
What is the SMILES notation for (2S,5S)-1-(2-bromoacetyl)pyrrolidine-2,5-dicarbonitrile?
The canonical SMILES for (2S,5S)-1-(2-bromoacetyl)pyrrolidine-2,5-dicarbonitrile is N#C[C@@H]1CC[C@@H](C#N)N1C(=O)CBr.
What is the InChIKey of (2S,5S)-1-(2-bromoacetyl)pyrrolidine-2,5-dicarbonitrile?
The InChIKey is RTOYOAYPWNAATO-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H8BrN3O/c9-3-8(13)12-6(4-10)1-2-7(12)5-11/h6-7H,1-3H2/t6-,7-/m0/s1.
What are the key properties of (2S,5S)-1-(2-bromoacetyl)pyrrolidine-2,5-dicarbonitrile?
(2S,5S)-1-(2-bromoacetyl)pyrrolidine-2,5-dicarbonitrile has a molecular weight of 242.08 g/mol, XLogP of 0.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-1-(2-bromoacetyl)pyrrolidine-2,5-dicarbonitrile is sourced from PubChem (CID 91541810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).