C26H22N6O3S — CID 91541998
N-[2-(4-aminoisoquinolin-7-yl)-5-methylpyrazol-3-yl]-4-(2-sulfamoylphenyl)benzamide (PubChem CID 91541998) has the molecular formula C26H22N6O3S and a molecular weight of 498.57 g/mol. Its IUPAC name is N-[2-(4-aminoisoquinolin-7-yl)-5-methylpyrazol-3-yl]-4-(2-sulfamoylphenyl)benzamide.
| Compound Name | N-[2-(4-aminoisoquinolin-7-yl)-5-methylpyrazol-3-yl]-4-(2-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 91541998 |
| Molecular Formula | C26H22N6O3S |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N-[2-(4-aminoisoquinolin-7-yl)-5-methylpyrazol-3-yl]-4-(2-sulfamoylphenyl)benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(-c3ccccc3S(N)(=O)=O)cc2)n(-c2ccc3c(N)cncc3c2)n1 |
| InChI | InChI=1S/C26H22N6O3S/c1-16-12-25(32(31-16)20-10-11-21-19(13-20)14-29-15-23(21)27)30-26(33)18-8-6-17(7-9-18)22-4-2-3-5-24(22)36(28,34)35/h2-15H,27H2,1H3,(H,30,33)(H2,28,34,35) |
| InChIKey | UXZCBMCCRDMDNX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |