C24H18N6O3S — CID 10140079
3-isoquinolin-7-yl-N-[4-(2-sulfamoylphenyl)phenyl]triazole-4-carboxamide (PubChem CID 10140079) has the molecular formula C24H18N6O3S and a molecular weight of 470.51 g/mol. Its IUPAC name is 3-isoquinolin-7-yl-N-[4-(2-sulfamoylphenyl)phenyl]triazole-4-carboxamide.
| Compound Name | 3-isoquinolin-7-yl-N-[4-(2-sulfamoylphenyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 10140079 |
| Molecular Formula | C24H18N6O3S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 3-isoquinolin-7-yl-N-[4-(2-sulfamoylphenyl)phenyl]triazole-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1ccc(NC(=O)c2cnnn2-c2ccc3ccncc3c2)cc1 |
| InChI | InChI=1S/C24H18N6O3S/c25-34(32,33)23-4-2-1-3-21(23)17-5-8-19(9-6-17)28-24(31)22-15-27-29-30(22)20-10-7-16-11-12-26-14-18(16)13-20/h1-15H,(H,28,31)(H2,25,32,33) |
| InChIKey | YJDOSEWOUIRFOD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |