C28H21N5O4S2 — CID 91132916
4-(3-formamidophenyl)-2-pyridin-3-yl-N-[4-(2-sulfamoylphenyl)phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 91132916) has the molecular formula C28H21N5O4S2 and a molecular weight of 555.64 g/mol. Its IUPAC name is 4-(3-formamidophenyl)-2-pyridin-3-yl-N-[4-(2-sulfamoylphenyl)phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-(3-formamidophenyl)-2-pyridin-3-yl-N-[4-(2-sulfamoylphenyl)phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 91132916 |
| Molecular Formula | C28H21N5O4S2 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.10 |
| IUPAC Name | 4-(3-formamidophenyl)-2-pyridin-3-yl-N-[4-(2-sulfamoylphenyl)phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1ccc(NC(=O)c2sc(-c3cccnc3)nc2-c2cccc(NC=O)c2)cc1 |
| InChI | InChI=1S/C28H21N5O4S2/c29-39(36,37)24-9-2-1-8-23(24)18-10-12-21(13-11-18)32-27(35)26-25(19-5-3-7-22(15-19)31-17-34)33-28(38-26)20-6-4-14-30-16-20/h1-17H,(H,31,34)(H,32,35)(H2,29,36,37) |
| InChIKey | UNLWRSMMKKVXOP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|