C24H21N5O4S2 — CID 90881753
4-(3-formamidophenyl)-2-(methylamino)-N-[4-(2-sulfamoylphenyl)phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 90881753) has the molecular formula C24H21N5O4S2 and a molecular weight of 507.60 g/mol. Its IUPAC name is 4-(3-formamidophenyl)-2-(methylamino)-N-[4-(2-sulfamoylphenyl)phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-(3-formamidophenyl)-2-(methylamino)-N-[4-(2-sulfamoylphenyl)phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 90881753 |
| Molecular Formula | C24H21N5O4S2 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | 4-(3-formamidophenyl)-2-(methylamino)-N-[4-(2-sulfamoylphenyl)phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | CNc1nc(-c2cccc(NC=O)c2)c(C(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C24H21N5O4S2/c1-26-24-29-21(16-5-4-6-18(13-16)27-14-30)22(34-24)23(31)28-17-11-9-15(10-12-17)19-7-2-3-8-20(19)35(25,32)33/h2-14H,1H3,(H,26,29)(H,27,30)(H,28,31)(H2,25,32,33) |
| InChIKey | WHWLPCASMHNBSX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 143.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|